* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-(2-FURYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-YLAMINE |
CAS: | 338793-16-1 |
English Synonyms: | 7-(2-FURYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-YLAMINE ; 7-(FURAN-2-YL)-[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE ; 7-(2-FURYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
MDL Number.: | MFCD00232506 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1cc(oc1)c2ccnc3n2nc(n3)N |
InChi: | InChI=1S/C9H7N5O/c10-8-12-9-11-4-3-6(14(9)13-8)7-2-1-5-15-7/h1-5H,(H2,10,13) |
InChiKey: | InChIKey=VWZMXGIAIXOTIP-UHFFFAOYSA-N |
Property |
|
Boiling Point: | MP: 262-264 DEG |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.