* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,7-DICHLORO-1,10-PHENANTHROLINE |
CAS: | 5394-23-0 |
English Synonyms: | 4,7-DICHLORO-1,10-PHENANTHROLINE |
MDL Number.: | MFCD00233882 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc2c(ccnc2c3c1c(ccn3)Cl)Cl |
InChi: | InChI=1S/C12H6Cl2N2/c13-9-3-5-15-11-7(9)1-2-8-10(14)4-6-16-12(8)11/h1-6H |
InChiKey: | InChIKey=GIEQBYJCGYHHSU-UHFFFAOYSA-N |
Property |
|
Melting Point: | 243-247 DEG C/243-247 °C/243-247 °C |
Comments: | RIDADR: UN 2811 6.1/PG 3 UNSPSC: 12352100 WGK: 3 |
Safety information |
|
Symbol: | GHS05 GHS06 |
Signal word: | Danger |
Hazard statements: | H301-H315-H318-H335 |
Precautionary statements: | P261-P280-P301 + P310-P305 + P351 + P338 |
hazard symbol: | Xn |
Risk Code: | R:22-37/38-41 |
Safe Code: | S:26-39 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.