* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-PHENYLPTERIDINE-2,4-DIOL |
English Synonyms: | 7-PHENYLPTERIDINE-2,4-DIOL |
MDL Number.: | MFCD00234774 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2cnc3c(n2)nc(nc3O)O |
InChi: | InChI=1S/C12H8N4O2/c17-11-9-10(15-12(18)16-11)14-8(6-13-9)7-4-2-1-3-5-7/h1-6H,(H2,14,15,16,17,18) |
InChiKey: | InChIKey=ZXXJZGLHZHPGGH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.