* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PHENYL-2-THIOXO-2,3-DIHYDROPTERIDIN-4(1H)-ONE |
| English Synonyms: | 7-PHENYL-2-THIOXO-2,3-DIHYDROPTERIDIN-4(1H)-ONE |
| MDL Number.: | MFCD00235070 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)c2cnc3c(n2)[nH]c(=S)[nH]c3=O |
| InChi: | InChI=1S/C12H8N4OS/c17-11-9-10(15-12(18)16-11)14-8(6-13-9)7-4-2-1-3-5-7/h1-6H,(H2,14,15,16,17,18) |
| InChiKey: | InChIKey=UOCIWPKYGYRADP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.