Molecular Structure:
CCD No.:CCD00106515
OTAVA-BB 7020665157
Formula:C18 H25 N O
MolWeight:271.401
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 7020665157 |
| English Synonyms： | OTAVA-BB 7020665157 |
| MDL Number.： | MFCD00235230 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCCCCOc1ccc2ccccc2c1CCN |
| InChi： | InChI=1S/C18H25NO/c1-2-3-4-7-14-20-18-11-10-15-8-5-6-9-16(15)17(18)12-13-19/h5-6,8-11H,2-4,7,12-14,19H2,1H3 |
| InChiKey： | InChIKey=PWXVGMWCVIWISO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
