* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GALACTOSE, D-[4,5-3H(N)]- |
| English Synonyms: | GALACTOSE, D-[4,5-3H(N)]- |
| MDL Number.: | MFCD00235348 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | [3H][C@@](O)(CO)[C@]([3H])(O)[C@H](O)[C@@H](O)C=O |
| InChi: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5+,6-/m0/s1/i4T,6T |
| InChiKey: | InChIKey=GZCGUPFRVQAUEE-GIDXGUHVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.