* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCOSE 6-PHOSPHATE, DISODIUM SALT, D-[1-14C]- |
| English Synonyms: | GLUCOSE 6-PHOSPHATE, DISODIUM SALT, D-[1-14C]- |
| MDL Number.: | MFCD00235349 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | [Na+].[Na+].O[C@H](COP([O-])([O-])=O)[C@@H](O)[C@H](O)[C@@H](O)[14CH]=O |
| InChi: | InChI=1S/C6H13O9P.2Na/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h1,3-6,8-11H,2H2,(H2,12,13,14);;/q;2*+1/p-2/t3-,4+,5+,6+;;/m0../s1/i1+2;; |
| InChiKey: | InChIKey=VQLXCAHGUGIEEL-FCRSLDJZSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.