* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUTAMIC ACID, L-[2,3-3H]- |
| English Synonyms: | GLUTAMIC ACID, L-[2,3-3H]- |
| MDL Number.: | MFCD00235350 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | [3H]C([3H])(CC(O)=O)[C@]([3H])(N)C(O)=O |
| InChi: | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i1T2,3T |
| InChiKey: | InChIKey=WHUUTDBJXJRKMK-UCELKYRWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.