Molecular Structure:
CCD No.:CCD00106588
GLUTATHIONE, [GLYCINE-2-3H]
Formula:C10 H15 N3 O6 S T2
MolWeight:311.341
![GLUTATHIONE, [GLYCINE-2-3H] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | GLUTATHIONE, [GLYCINE-2-3H] |
| English Synonyms： | GLUTATHIONE, [GLYCINE-2-3H] |
| MDL Number.： | MFCD00235353 |
| H bond acceptor： | 9 |
| H bond donor： | 5 |
| Smile： | [3H]C([3H])(C(=O)O)NC(=O)[C@H](CS)NC(=O)CC[C@@H](C(=O)O)N |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
