* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCEROL-3-PHOSPHATE [2-3H] |
| English Synonyms: | GLYCEROL-3-PHOSPHATE [2-3H] |
| MDL Number.: | MFCD00235354 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | [3H][C@@](O)(CO)COP(O)(O)=O |
| InChi: | InChI=1S/C3H9O6P/c4-1-3(5)2-9-10(6,7)8/h3-5H,1-2H2,(H2,6,7,8)/t3-/m0/s1/i3T |
| InChiKey: | InChIKey=AWUCVROLDVIAJX-BOKRTCQGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.