* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HYDROXYPROGESTERONE, 17ALPHA-[1,2-3H(N)]- |
English Synonyms: | HYDROXYPROGESTERONE, 17ALPHA-[1,2-3H(N)]- |
MDL Number.: | MFCD00235371 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | [H][C@@]12CC[C@](O)(C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C([3H])([3H])C([3H])([3H])[C@]12C |
InChi: | InChI=1S/C21H30O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h12,16-18,24H,4-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1/i6T2,9T2 |
InChiKey: | InChIKey=DBPWSSGDRRHUNT-XWBBJRNSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.