* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YM-09151-2, [N-METHYL-3H]- |
| English Synonyms: | YM-09151-2, [N-METHYL-3H]- |
| MDL Number.: | MFCD00235500 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | [3H]C([3H])([3H])NC1=C(Cl)C=C(C(=O)NC2CCN(CC3=CC=CC=C3)C2C)C(OC)=C1 |
| InChi: | InChI=1S/C21H26ClN3O2/c1-14-18(9-10-25(14)13-15-7-5-4-6-8-15)24-21(26)16-11-17(22)19(23-2)12-20(16)27-3/h4-8,11-12,14,18,23H,9-10,13H2,1-3H3,(H,24,26)/i2T3 |
| InChiKey: | InChIKey=KRVOJOCLBAAKSJ-BHTRQJOGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.