* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINPIROLE [N-PROPYL-3H]- |
English Synonyms: | QUINPIROLE [N-PROPYL-3H]- |
MDL Number.: | MFCD00235538 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | [H][C@]12CCCN(CC([3H])([3H])C([3H])([3H])[3H])[C@]1([H])CC1=CNN=C1C2 |
InChi: | InChI=1S/C13H21N3/c1-2-5-16-6-3-4-10-7-12-11(8-13(10)16)9-14-15-12/h9-10,13H,2-8H2,1H3,(H,14,15)/t10-,13-/m1/s1/i1T3,2T2 |
InChiKey: | InChIKey=FTSUPYGMFAPCFZ-IKYKFNFUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.