* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RAUWOLSCINE, [METHYL-3H]- |
English Synonyms: | RAUWOLSCINE, [METHYL-3H]- |
MDL Number.: | MFCD00235589 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | [H][C@]12CC[C@H](O)[C@@H](C(=O)OC([3H])([3H])[3H])[C@@]1([H])C[C@]1([H])N(CCC3=C1NC1=C3C=CC=C1)C2 |
InChi: | InChI=1S/C21H26N2O3/c1-26-21(25)19-15-10-17-20-14(13-4-2-3-5-16(13)22-20)8-9-23(17)11-12(15)6-7-18(19)24/h2-5,12,15,17-19,22,24H,6-11H2,1H3/t12-,15+,17+,18+,19+/m1/s1/i1T3 |
InChiKey: | InChIKey=BLGXFZZNTVWLAY-ADAAJRJBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.