* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RO 15-1788, [N-METHYL-3H]- |
English Synonyms: | RO 15-1788, [N-METHYL-3H]- |
MDL Number.: | MFCD00235595 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | [3H]C([3H])([3H])N1C=C2N(CN=C2C(=O)OCC)C2=C(C=C(F)C=C2)C1=O |
InChi: | InChI=1S/C15H14FN3O3/c1-3-22-15(21)13-12-7-18(2)14(20)10-6-9(16)4-5-11(10)19(12)8-17-13/h4-7H,3,8H2,1-2H3/i2T3 |
InChiKey: | InChIKey=CDBJBUDFGZHNOK-BHTRQJOGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.