* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GBR 12935, [PROPYLENE-2,3-3H]- |
| English Synonyms: | GBR 12935, [PROPYLENE-2,3-3H]- |
| MDL Number.: | MFCD00235627 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | [3H]C([3H])(CN1CCN(CCOC(C2=CC=CC=C2)C2=CC=CC=C2)CC1)C([3H])([3H])C1=CC=CC=C1 |
| InChi: | InChI=1S/C28H34N2O/c1-4-11-25(12-5-1)13-10-18-29-19-21-30(22-20-29)23-24-31-28(26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-9,11-12,14-17,28H,10,13,18-24H2/i10T2,13T2 |
| InChiKey: | InChIKey=RAQPOZGWANIDQT-FSRUAZQVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.