* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RO 15-4513, [7,9-3H]- |
| English Synonyms: | RO 15-4513, [7,9-3H]- |
| MDL Number.: | MFCD00235630 |
| H bond acceptor: | 9 |
| H bond donor: | 0 |
| Smile: | [3H]C1=CC2=C(C([3H])=C1N=[N+]=[N-])C(=O)N(C)CC1=C(N=CN21)C(=O)OCC |
| InChi: | InChI=1S/C15H14N6O3/c1-3-24-15(23)13-12-7-20(2)14(22)10-6-9(18-19-16)4-5-11(10)21(12)8-17-13/h4-6,8H,3,7H2,1-2H3/i4T,6T |
| InChiKey: | InChIKey=CFSOJZTUTOQNIA-OOXUDHARSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.