* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RYANODINE, [9,21-3H(N)]- |
English Synonyms: | RYANODINE, [9,21-3H(N)]- |
MDL Number.: | MFCD00235637 |
H bond acceptor: | 10 |
H bond donor: | 7 |
Smile: | [3H]C[C@@]1([3H])CC[C@]2(O)[C@]3(C)C[C@]4(O)O[C@@]2([C@@H]1O)[C@]1(O)[C@@]3(O)[C@H](OC(=O)C2=CC=CN2)[C@](O)(C(C)C)[C@@]41C |
InChi: | InChI=1S/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3/t13-,15+,17+,18-,19+,20-,21-,22+,23+,24+,25+/m0/s1/i3T,13T |
InChiKey: | InChIKey=JJSYXNQGLHBRRK-ZTGGXEFWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.