* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZOLPIDEM, [PHENYL-2,6-3H]- |
| English Synonyms: | ZOLPIDEM, [PHENYL-2,6-3H]- |
| MDL Number.: | MFCD00235645 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | [3H]C1=CC(C)=CC([3H])=C1C1=C(CC(=O)N(C)C)N2C=C(C)C=CC2=N1 |
| InChi: | InChI=1S/C19H21N3O/c1-13-5-8-15(9-6-13)19-16(11-18(23)21(3)4)22-12-14(2)7-10-17(22)20-19/h5-10,12H,11H2,1-4H3/i8T,9T |
| InChiKey: | InChIKey=ZAFYATHCZYHLPB-BGVJATAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.