* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RTI-55, [125I]- |
| English Synonyms: | RTI-55, [125I]- ; RTI-55, [125]- |
| MDL Number.: | MFCD00235677 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | [H][C@]12CC[C@]([H])([C@H]([C@H](C1)C1=CC=C([125I])C=C1)C(=O)OC)N2C |
| InChi: | InChI=1S/C16H20INO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1/i17-2 |
| InChiKey: | InChIKey=SIIICDNNMDMWCI-LRRSBLKXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.