* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RTI-121, [125I]- |
| English Synonyms: | RTI-121, [125I]- |
| MDL Number.: | MFCD00235686 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | [H][C@]12CC[C@]([H])([C@H]([C@H](C1)C1=CC=C([125I])C=C1)C(=O)OC(C)C)N2C |
| InChi: | InChI=1S/C18H24INO2/c1-11(2)22-18(21)17-15(12-4-6-13(19)7-5-12)10-14-8-9-16(17)20(14)3/h4-7,11,14-17H,8-10H2,1-3H3/t14-,15+,16+,17-/m0/s1/i19-2 |
| InChiKey: | InChIKey=ZAQLTGAFVMGUMB-MOWWFXMMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.