* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-D-ALA-D-ALA-OME |
CAS: | 19914-26-2 |
English Synonyms: | Z-D-ALA-D-ALA-OME |
MDL Number.: | MFCD00235795 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | C[C@H](C(=O)N[C@H](C)C(=O)OC)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C15H20N2O5/c1-10(13(18)16-11(2)14(19)21-3)17-15(20)22-9-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3,(H,16,18)(H,17,20)/t10-,11-/m1/s1 |
InChiKey: | InChIKey=CUCAZZQPISJXOS-GHMZBOCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.