* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLIBENCLAMIDE, [CYCLOHEXYL-2,3-3H(N)]- |
| English Synonyms: | GLIBENCLAMIDE, [CYCLOHEXYL-2,3-3H(N)]- ; GLYBURIDE 3-3H(N)- |
| MDL Number.: | MFCD00236187 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | [3H]C1([3H])CCCC(NC(=O)NS(=O)(=O)C2=CC=C(CCNC(=O)C3=C(OC)C=CC(Cl)=C3)C=C2)C1([3H])[3H] |
| InChi: | InChI=1S/C23H28ClN3O5S/c1-32-21-12-9-17(24)15-20(21)22(28)25-14-13-16-7-10-19(11-8-16)33(30,31)27-23(29)26-18-5-3-2-4-6-18/h7-12,15,18H,2-6,13-14H2,1H3,(H,25,28)(H2,26,27,29)/i3T2,5T2 |
| InChiKey: | InChIKey=ZNNLBTZKUZBEKO-WGHAWMPFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.