* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 35,428, [N-METHYL-3H]- |
English Synonyms: | WIN 35,428, [N-METHYL-3H]- |
MDL Number.: | MFCD00236189 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | [H][C@]12CC[C@]([H])([C@H]([C@H](C1)C1=CC=C(F)C=C1)C(=O)OC)N2C([3H])([3H])[3H] |
InChi: | InChI=1S/C16H20FNO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1/i1T3 |
InChiKey: | InChIKey=QUSLQENMLDRCTO-CJAKHHAASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.