* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GRAVEOLINE |
CAS: | 485-61-0 |
English Synonyms: | FOLIOSINE ; GRAVEOLINE |
MDL Number.: | MFCD00236478 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cn1c2ccccc2c(=O)cc1c3ccc4c(c3)OCO4 |
InChi: | InChI=1S/C17H13NO3/c1-18-13-5-3-2-4-12(13)15(19)9-14(18)11-6-7-16-17(8-11)21-10-20-16/h2-9H,10H2,1H3 |
InChiKey: | InChIKey=COBBNRKBTCBWQP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.