* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-SER(TBU)-AMC HCL |
CAS: | 201855-41-6 |
English Synonyms: | H-SER(TBU)-AMC HCL |
MDL Number.: | MFCD00237253 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](COC(C)(C)C)N.Cl |
InChi: | InChI=1S/C17H22N2O4.ClH/c1-10-7-15(20)23-14-8-11(5-6-12(10)14)19-16(21)13(18)9-22-17(2,3)4;/h5-8,13H,9,18H2,1-4H3,(H,19,21);1H/t13-;/m0./s1 |
InChiKey: | InChIKey=AEVYPLSHUWOTFZ-ZOWNYOTGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.