* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-D-ARG(Z)2-OSU |
| CAS: | 200191-86-2 |
| English Synonyms: | Z-D-ARG(Z)2-OSU |
| MDL Number.: | MFCD00237333 |
| H bond acceptor: | 15 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)COC(=O)N[C@H](CCCNC(=N)N(C(=O)OCc2ccccc2)C(=O)OCc3ccccc3)C(=O)ON4C(=O)CCC4=O |
| InChi: | InChI=1S/C34H35N5O10/c35-31(38(33(44)47-22-25-13-6-2-7-14-25)34(45)48-23-26-15-8-3-9-16-26)36-20-10-17-27(30(42)49-39-28(40)18-19-29(39)41)37-32(43)46-21-24-11-4-1-5-12-24/h1-9,11-16,27H,10,17-23H2,(H2,35,36)(H,37,43)/t27-/m1/s1 |
| InChiKey: | InChIKey=ANAAWKCGELNJJW-HHHXNRCGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.