* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS(Z)-ONP |
| English Synonyms: | Z-HIS(Z)-ONP |
| MDL Number.: | MFCD00237351 |
| H bond acceptor: | 12 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2cn(cn2)C(=O)OCc3ccccc3)C(=O)Oc4ccc(cc4)[N+](=O)[O-] |
| InChi: | InChI=1S/C28H24N4O8/c33-26(40-24-13-11-23(12-14-24)32(36)37)25(30-27(34)38-17-20-7-3-1-4-8-20)15-22-16-31(19-29-22)28(35)39-18-21-9-5-2-6-10-21/h1-14,16,19,25H,15,17-18H2,(H,30,34)/t25-/m0/s1 |
| InChiKey: | InChIKey=NAKBGYPGYOMBRZ-VWLOTQADSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.