* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FA-PHE-VAL-NH2 |
| CAS: | 93936-27-7 |
| English Synonyms: | FA-PHE-VAL-NH2 |
| MDL Number.: | MFCD00237649 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC(C)[C@@H](C(=O)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c2ccco2 |
| InChi: | InChI=1S/C21H25N3O4/c1-14(2)19(20(22)26)24-21(27)17(13-15-7-4-3-5-8-15)23-18(25)11-10-16-9-6-12-28-16/h3-12,14,17,19H,13H2,1-2H3,(H2,22,26)(H,23,25)(H,24,27)/b11-10+/t17-,19-/m0/s1 |
| InChiKey: | InChIKey=MOIXOFBAXPHGFF-UKMAJIJPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.