* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GAMMA-L-GLU-D-ALA |
| CAS: | 42592-56-3 |
| English Synonyms: | H-GAMMA-GLU-D-ALA-OH ; GAMMA-L-GLU-D-ALA |
| MDL Number.: | MFCD00237864 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | C[C@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C8H14N2O5/c1-4(7(12)13)10-6(11)3-2-5(9)8(14)15/h4-5H,2-3,9H2,1H3,(H,10,11)(H,12,13)(H,14,15)/t4-,5+/m1/s1 |
| InChiKey: | InChIKey=WQXXXVRAFAKQJM-UHNVWZDZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.