* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-LYSYL-L-PROLINE |
| English Synonyms: | L-LYSYL-L-PROLINE |
| MDL Number.: | MFCD00238066 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | C1C[C@H](N(C1)C(=O)[C@H](CCCCN)N)C(=O)O |
| InChi: | InChI=1S/C11H21N3O3/c12-6-2-1-4-8(13)10(15)14-7-3-5-9(14)11(16)17/h8-9H,1-7,12-13H2,(H,16,17)/t8-,9-/m0/s1 |
| InChiKey: | InChIKey=AIXUQKMMBQJZCU-IUCAKERBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.