* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-PRO-GLN-PHE-TYR-OH HCL |
| CAS: | 787539-66-6 |
| English Synonyms: | H-PRO-GLN-PHE-TYR-OH HCL |
| MDL Number.: | MFCD00238142 |
| H bond acceptor: | 12 |
| H bond donor: | 7 |
| Smile: | c1ccc(cc1)C[C@@H](C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@@H]3CCCN3.Cl |
| InChi: | InChI=1S/C28H35N5O7.ClH/c29-24(35)13-12-21(31-25(36)20-7-4-14-30-20)26(37)32-22(15-17-5-2-1-3-6-17)27(38)33-23(28(39)40)16-18-8-10-19(34)11-9-18;/h1-3,5-6,8-11,20-23,30,34H,4,7,12-16H2,(H2,29,35)(H,31,36)(H,32,37)(H,33,38)(H,39,40);1H/t20-,21-,22-,23-;/m0./s1 |
| InChiKey: | InChIKey=VVRYIFJKRKUFLI-JSEXCYGQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.