* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-THR-MET-OH |
| CAS: | 90729-28-5 |
| English Synonyms: | H-THR-MET-OH ; L-THR-MET |
| MDL Number.: | MFCD00238185 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | C[C@H]([C@@H](C(=O)N[C@@H](CCSC)C(=O)O)N)O |
| InChi: | InChI=1S/C9H18N2O4S/c1-5(12)7(10)8(13)11-6(9(14)15)3-4-16-2/h5-7,12H,3-4,10H2,1-2H3,(H,11,13)(H,14,15)/t5-,6+,7+/m1/s1 |
| InChiKey: | InChIKey=APIDTRXFGYOLLH-VQVTYTSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.