* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-TRP-ARG-OH 2HCL |
English Synonyms: | H-TRP-ARG-OH 2HCL |
MDL Number.: | MFCD00238195 |
H bond acceptor: | 9 |
H bond donor: | 7 |
Smile: | c1ccc2c(c1)c(c[nH]2)C[C@@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)N.Cl.Cl |
InChi: | InChI=1S/C17H24N6O3.2ClH/c18-12(8-10-9-22-13-5-2-1-4-11(10)13)15(24)23-14(16(25)26)6-3-7-21-17(19)20;;/h1-2,4-5,9,12,14,22H,3,6-8,18H2,(H,23,24)(H,25,26)(H4,19,20,21);2*1H/t12-,14-;;/m0../s1 |
InChiKey: | InChIKey=VWCHOPJBXDMPGL-FORAGAHYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.