* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-ALA-NH2 |
| CAS: | 50444-54-7 |
| English Synonyms: | Z-ALA-ALA-NH2 |
| MDL Number.: | MFCD00238398 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | C[C@@H](C(=O)N)NC(=O)[C@H](C)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C14H19N3O4/c1-9(12(15)18)16-13(19)10(2)17-14(20)21-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H2,15,18)(H,16,19)(H,17,20)/t9-,10-/m0/s1 |
| InChiKey: | InChIKey=WEIOJLPDGBBVCH-UWVGGRQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.