* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-ALA-PNA |
| CAS: | 61043-58-1 |
| English Synonyms: | Z-ALA-ALA-PNA |
| MDL Number.: | MFCD00238399 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | C[C@@H](C(=O)Nc1ccc(cc1)[N+](=O)[O-])NC(=O)[C@H](C)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C20H22N4O6/c1-13(19(26)23-16-8-10-17(11-9-16)24(28)29)21-18(25)14(2)22-20(27)30-12-15-6-4-3-5-7-15/h3-11,13-14H,12H2,1-2H3,(H,21,25)(H,22,27)(H,23,26)/t13-,14-/m0/s1 |
| InChiKey: | InChIKey=TUBKJDFIMPSKNT-KBPBESRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.