* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-LYS-OH |
| CAS: | 76264-07-8 |
| English Synonyms: | Z-ALA-LYS-OH |
| MDL Number.: | MFCD00238404 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C17H25N3O5/c1-12(15(21)20-14(16(22)23)9-5-6-10-18)19-17(24)25-11-13-7-3-2-4-8-13/h2-4,7-8,12,14H,5-6,9-11,18H2,1H3,(H,19,24)(H,20,21)(H,22,23)/t12-,14-/m0/s1 |
| InChiKey: | InChIKey=RQMDMYNAXPFMCC-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.