* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-PRO-4M-BETANA |
| CAS: | 74305-55-8 |
| English Synonyms: | Z-ALA-PRO-4M-BETANA ; Z-ALA-PRO-4MBNA |
| MDL Number.: | MFCD00238406 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | C[C@@H](C(=O)N1CCC[C@H]1C(=O)Nc2cc3ccccc3c(c2)OC)NC(=O)OCc4ccccc4 |
| InChi: | InChI=1S/C27H29N3O5/c1-18(28-27(33)35-17-19-9-4-3-5-10-19)26(32)30-14-8-13-23(30)25(31)29-21-15-20-11-6-7-12-22(20)24(16-21)34-2/h3-7,9-12,15-16,18,23H,8,13-14,17H2,1-2H3,(H,28,33)(H,29,31)/t18-,23-/m0/s1 |
| InChiKey: | InChIKey=JGMPJPOIQUVXIJ-MBSDFSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.