* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-PRO-LEU-OH |
| CAS: | 108074-19-7 |
| English Synonyms: | Z-ALA-PRO-LEU-OH |
| MDL Number.: | MFCD00238408 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C22H31N3O6/c1-14(2)12-17(21(28)29)24-19(26)18-10-7-11-25(18)20(27)15(3)23-22(30)31-13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-18H,7,10-13H2,1-3H3,(H,23,30)(H,24,26)(H,28,29)/t15-,17-,18-/m0/s1 |
| InChiKey: | InChIKey=TUMZHRRIVIEDCX-SZMVWBNQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.