* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ALA-PRO-PNA |
| CAS: | 66382-56-7 |
| English Synonyms: | Z-ALA-PRO-PNA |
| MDL Number.: | MFCD00238411 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | C[C@@H](C(=O)N1CCC[C@H]1C(=O)Nc2ccc(cc2)[N+](=O)[O-])NC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C22H24N4O6/c1-15(23-22(29)32-14-16-6-3-2-4-7-16)21(28)25-13-5-8-19(25)20(27)24-17-9-11-18(12-10-17)26(30)31/h2-4,6-7,9-12,15,19H,5,8,13-14H2,1H3,(H,23,29)(H,24,27)/t15-,19-/m0/s1 |
| InChiKey: | InChIKey=KFRUDZOHZFJLLZ-KXBFYZLASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.