* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ASP-MET-OH |
| CAS: | 209548-49-2 |
| English Synonyms: | Z-ASP-MET-OH |
| MDL Number.: | MFCD00238418 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | CSCC[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C17H22N2O7S/c1-27-8-7-12(16(23)24)18-15(22)13(9-14(20)21)19-17(25)26-10-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3,(H,18,22)(H,19,25)(H,20,21)(H,23,24)/t12-,13-/m0/s1 |
| InChiKey: | InChIKey=FYSQBJYJNOXEDS-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.