* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-D-ALA-GLY-OH |
| CAS: | 34286-66-3 |
| English Synonyms: | Z-D-ALA-GLY-OH |
| MDL Number.: | MFCD00238424 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | C[C@H](C(=O)NCC(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C13H16N2O5/c1-9(12(18)14-7-11(16)17)15-13(19)20-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,18)(H,15,19)(H,16,17)/t9-/m1/s1 |
| InChiKey: | InChIKey=RNBMQRYMCAVZPN-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.