* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-ALA-MET-AMC |
| English Synonyms: | Z-GLY-ALA-MET-AMC |
| MDL Number.: | MFCD00238440 |
| H bond acceptor: | 11 |
| H bond donor: | 4 |
| Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](CCSC)NC(=O)[C@H](C)NC(=O)CNC(=O)OCc3ccccc3 |
| InChi: | InChI=1S/C28H32N4O7S/c1-17-13-25(34)39-23-14-20(9-10-21(17)23)31-27(36)22(11-12-40-3)32-26(35)18(2)30-24(33)15-29-28(37)38-16-19-7-5-4-6-8-19/h4-10,13-14,18,22H,11-12,15-16H2,1-3H3,(H,29,37)(H,30,33)(H,31,36)(H,32,35)/t18-,22-/m0/s1 |
| InChiKey: | InChIKey=UJLOGGPANQIDLV-AVRDEDQJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.