* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-GLY-HIS-OH |
| CAS: | 52396-73-3 |
| English Synonyms: | Z-GLY-GLY-HIS-OH |
| MDL Number.: | MFCD00238453 |
| H bond acceptor: | 11 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)NCC(=O)N[C@@H](Cc2c[nH]cn2)C(=O)O |
| InChi: | InChI=1S/C18H21N5O6/c24-15(8-21-18(28)29-10-12-4-2-1-3-5-12)20-9-16(25)23-14(17(26)27)6-13-7-19-11-22-13/h1-5,7,11,14H,6,8-10H2,(H,19,22)(H,20,24)(H,21,28)(H,23,25)(H,26,27)/t14-/m0/s1 |
| InChiKey: | InChIKey=PWNQBHDTOAIVDG-AWEZNQCLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.