* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-GLY-TYR-NH2 |
| CAS: | 17263-44-4 |
| English Synonyms: | Z-GLY-TYR-NH2 |
| MDL Number.: | MFCD00238462 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)COC(=O)NCC(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N |
| InChi: | InChI=1S/C19H21N3O5/c20-18(25)16(10-13-6-8-15(23)9-7-13)22-17(24)11-21-19(26)27-12-14-4-2-1-3-5-14/h1-9,16,23H,10-12H2,(H2,20,25)(H,21,26)(H,22,24)/t16-/m0/s1 |
| InChiKey: | InChIKey=YYZXAAJFIOIYGD-INIZCTEOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.