* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-HIS-LEU-HIS-BNA |
CAS: | 202002-00-4 |
English Synonyms: | Z-HIS-LEU-HIS-BNA |
MDL Number.: | MFCD00238463 |
H bond acceptor: | 13 |
H bond donor: | 6 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)Nc2ccc3ccccc3c2)NC(=O)[C@H](Cc4c[nH]cn4)NC(=O)OCc5ccccc5 |
InChi: | InChI=1S/C36H40N8O5/c1-23(2)14-30(42-35(47)32(17-29-19-38-22-40-29)44-36(48)49-20-24-8-4-3-5-9-24)34(46)43-31(16-28-18-37-21-39-28)33(45)41-27-13-12-25-10-6-7-11-26(25)15-27/h3-13,15,18-19,21-23,30-32H,14,16-17,20H2,1-2H3,(H,37,39)(H,38,40)(H,41,45)(H,42,47)(H,43,46)(H,44,48)/t30-,31-,32-/m0/s1 |
InChiKey: | InChIKey=GLGPSUWTUJJYFQ-CPCREDONSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.