* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LYS(Z)-GLY-OH |
| CAS: | 37941-54-1 |
| English Synonyms: | Z-LYS(Z)-GLY-OH |
| MDL Number.: | MFCD00238478 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | c1ccc(cc1)COC(=O)NCCCC[C@@H](C(=O)NCC(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C24H29N3O7/c28-21(29)15-26-22(30)20(27-24(32)34-17-19-11-5-2-6-12-19)13-7-8-14-25-23(31)33-16-18-9-3-1-4-10-18/h1-6,9-12,20H,7-8,13-17H2,(H,25,31)(H,26,30)(H,27,32)(H,28,29)/t20-/m0/s1 |
| InChiKey: | InChIKey=YMHXRKMCTBMGTQ-FQEVSTJZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.