* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-MET-MET-OH |
CAS: | 61413-48-7 |
English Synonyms: | Z-MET-MET-OH |
MDL Number.: | MFCD00238486 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CSCC[C@@H](C(=O)N[C@@H](CCSC)C(=O)O)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C18H26N2O5S2/c1-26-10-8-14(16(21)19-15(17(22)23)9-11-27-2)20-18(24)25-12-13-6-4-3-5-7-13/h3-7,14-15H,8-12H2,1-2H3,(H,19,21)(H,20,24)(H,22,23)/t14-,15-/m0/s1 |
InChiKey: | InChIKey=HKYAAYRIWCNNMU-GJZGRUSLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.