* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-ASP-OH |
English Synonyms: | Z-PHE-ASP-OH |
MDL Number.: | MFCD00238493 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C21H22N2O7/c24-18(25)12-17(20(27)28)22-19(26)16(11-14-7-3-1-4-8-14)23-21(29)30-13-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,22,26)(H,23,29)(H,24,25)(H,27,28)/t16-,17-/m0/s1 |
InChiKey: | InChIKey=FSQCCXORUNZZSC-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.