* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-CIT-AMC |
CAS: | 92745-52-3 |
English Synonyms: | Z-PHE-CIT-AMC |
MDL Number.: | MFCD00238494 |
H bond acceptor: | 12 |
H bond donor: | 5 |
Smile: | Cc1cc(=O)oc2c1ccc(c2)NC(=O)[C@H](CCCNC(=O)N)NC(=O)[C@H](Cc3ccccc3)NC(=O)OCc4ccccc4 |
InChi: | InChI=1S/C33H35N5O7/c1-21-17-29(39)45-28-19-24(14-15-25(21)28)36-30(40)26(13-8-16-35-32(34)42)37-31(41)27(18-22-9-4-2-5-10-22)38-33(43)44-20-23-11-6-3-7-12-23/h2-7,9-12,14-15,17,19,26-27H,8,13,16,18,20H2,1H3,(H,36,40)(H,37,41)(H,38,43)(H3,34,35,42)/t26-,27-/m0/s1 |
InChiKey: | InChIKey=FUEOJGPMXYDCQT-SVBPBHIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.